Converts glyceraldehyde-3-phosphate (G3P) into 1,3-Bisphospho-D-glycerate (BPG). This is a vital step in glycolysis (as are all the steps) but the enzyme has some
other activities. These include binding viral
RNA which sometimes inhibits and sometimes promotes viral growth.
Product:
[C@2H]([OH])([C@2H2][O][P@2](=[O])([O-])[O-])[C](=[O])[O][P@2](=[O])([O-])[O-]
The mechanism:
O
|
R-C=O -Cys-SH-> R-C-S-Cys (a thiohemiacetal) -NAD-> R-C=O
| | |
H H (thioester) Cys-S
The cys is then deacetylated by a phosphate. In
ALDH, the same mechanism occurs, but the deacetylation step uses a water molecule to hydrolyse.